C15H17F3N2O3 — CID 99826475
(2R)-N-methyl-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-2-carboxamide (PubChem CID 99826475) has the molecular formula C15H17F3N2O3 and a molecular weight of 330.31 g/mol. Its IUPAC name is (2R)-N-methyl-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-methyl-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 99826475 |
| Molecular Formula | C15H17F3N2O3 |
| Molecular Weight | 330.31 g/mol |
| Exact Mass | 330.12 |
| IUPAC Name | (2R)-N-methyl-5-oxo-N-[2-[4-(trifluoromethyl)phenoxy]ethyl]pyrrolidine-2-carboxamide |
| SMILES | CN(CCOc1ccc(C(F)(F)F)cc1)C(=O)[C@H]1CCC(=O)N1 |
| InChI | InChI=1S/C15H17F3N2O3/c1-20(14(22)12-6-7-13(21)19-12)8-9-23-11-4-2-10(3-5-11)15(16,17)18/h2-5,12H,6-9H2,1H3,(H,19,21)/t12-/m1/s1 |
| InChIKey | PRIXAKLAWMRFNR-GFCCVEGCSA-N |
| XLogP | 1.82 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.31 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |