C19H24N2O3 — CID 99827233
N-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]-2-oxo-1H-quinoline-3-carboxamide (PubChem CID 99827233) has the molecular formula C19H24N2O3 and a molecular weight of 328.41 g/mol. Its IUPAC name is N-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]-2-oxo-1H-quinoline-3-carboxamide.
| Compound Name | N-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]-2-oxo-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 99827233 |
| Molecular Formula | C19H24N2O3 |
| Molecular Weight | 328.41 g/mol |
| Exact Mass | 328.18 |
| IUPAC Name | N-[(2S)-2-cyclohexyl-1-hydroxypropan-2-yl]-2-oxo-1H-quinoline-3-carboxamide |
| SMILES | C[C@](CO)(NC(=O)c1cc2ccccc2[nH]c1=O)C1CCCCC1 |
| InChI | InChI=1S/C19H24N2O3/c1-19(12-22,14-8-3-2-4-9-14)21-18(24)15-11-13-7-5-6-10-16(13)20-17(15)23/h5-7,10-11,14,22H,2-4,8-9,12H2,1H3,(H,20,23)(H,21,24)/t19-/m1/s1 |
| InChIKey | ZPOXKCSZLGILRW-LJQANCHMSA-N |
| XLogP | 2.59 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.41 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |