C19H24N4O3 — CID 99829546
(E)-3-(3,4-dimethoxyphenyl)-N-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]prop-2-enamide (PubChem CID 99829546) has the molecular formula C19H24N4O3 and a molecular weight of 356.43 g/mol. Its IUPAC name is (E)-3-(3,4-dimethoxyphenyl)-N-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]prop-2-enamide.
| Compound Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]prop-2-enamide |
|---|---|
| PubChem CID | 99829546 |
| Molecular Formula | C19H24N4O3 |
| Molecular Weight | 356.43 g/mol |
| Exact Mass | 356.18 |
| IUPAC Name | (E)-3-(3,4-dimethoxyphenyl)-N-[[2-(dimethylamino)-6-methylpyrimidin-4-yl]methyl]prop-2-enamide |
| SMILES | COc1ccc(/C=C/C(=O)NCc2cc(C)nc(N(C)C)n2)cc1OC |
| InChI | InChI=1S/C19H24N4O3/c1-13-10-15(22-19(21-13)23(2)3)12-20-18(24)9-7-14-6-8-16(25-4)17(11-14)26-5/h6-11H,12H2,1-5H3,(H,20,24)/b9-7+ |
| InChIKey | XHWVHJIOZQBBOZ-VQHVLOKHSA-N |
| XLogP | 2.20 |
| TPSA | 76.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.43 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|