C14H24N4O2 — CID 99830772
1-(2-tert-butylpyrazol-3-yl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea (PubChem CID 99830772) has the molecular formula C14H24N4O2 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(2-tert-butylpyrazol-3-yl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea.
| Compound Name | 1-(2-tert-butylpyrazol-3-yl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea |
|---|---|
| PubChem CID | 99830772 |
| Molecular Formula | C14H24N4O2 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.19 |
| IUPAC Name | 1-(2-tert-butylpyrazol-3-yl)-3-[(1R,2R)-2-hydroxycyclohexyl]urea |
| SMILES | CC(C)(C)n1nccc1NC(=O)N[C@@H]1CCCC[C@H]1O |
| InChI | InChI=1S/C14H24N4O2/c1-14(2,3)18-12(8-9-15-18)17-13(20)16-10-6-4-5-7-11(10)19/h8-11,19H,4-7H2,1-3H3,(H2,16,17,20)/t10-,11-/m1/s1 |
| InChIKey | LKTKJEIDBKFGGO-GHMZBOCLSA-N |
| XLogP | 2.06 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |