C16H26N6O — CID 164636891
1-(2-tert-butylpyrazol-3-yl)-3-[(1S)-2-methyl-1-(1-methylpyrazol-4-yl)propyl]urea (PubChem CID 164636891) has the molecular formula C16H26N6O and a molecular weight of 318.43 g/mol. Its IUPAC name is 1-(2-tert-butylpyrazol-3-yl)-3-[(1S)-2-methyl-1-(1-methylpyrazol-4-yl)propyl]urea.
| Compound Name | 1-(2-tert-butylpyrazol-3-yl)-3-[(1S)-2-methyl-1-(1-methylpyrazol-4-yl)propyl]urea |
|---|---|
| PubChem CID | 164636891 |
| Molecular Formula | C16H26N6O |
| Molecular Weight | 318.43 g/mol |
| Exact Mass | 318.22 |
| IUPAC Name | 1-(2-tert-butylpyrazol-3-yl)-3-[(1S)-2-methyl-1-(1-methylpyrazol-4-yl)propyl]urea |
| SMILES | CC(C)[C@H](NC(=O)Nc1ccnn1C(C)(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C16H26N6O/c1-11(2)14(12-9-18-21(6)10-12)20-15(23)19-13-7-8-17-22(13)16(3,4)5/h7-11,14H,1-6H3,(H2,19,20,23)/t14-/m0/s1 |
| InChIKey | BFEFTGRIYAMVOL-AWEZNQCLSA-N |
| XLogP | 2.89 |
| TPSA | 76.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.43 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |