C13H24N4O3S — CID 138024589
3-(dimethylsulfamoyl)-N-[2-methyl-1-(1-methylpyrazol-4-yl)propyl]propanamide (PubChem CID 138024589) has the molecular formula C13H24N4O3S and a molecular weight of 316.43 g/mol. Its IUPAC name is 3-(dimethylsulfamoyl)-N-[2-methyl-1-(1-methylpyrazol-4-yl)propyl]propanamide.
| Compound Name | 3-(dimethylsulfamoyl)-N-[2-methyl-1-(1-methylpyrazol-4-yl)propyl]propanamide |
|---|---|
| PubChem CID | 138024589 |
| Molecular Formula | C13H24N4O3S |
| Molecular Weight | 316.43 g/mol |
| Exact Mass | 316.16 |
| IUPAC Name | 3-(dimethylsulfamoyl)-N-[2-methyl-1-(1-methylpyrazol-4-yl)propyl]propanamide |
| SMILES | CC(C)C(NC(=O)CCS(=O)(=O)N(C)C)c1cnn(C)c1 |
| InChI | InChI=1S/C13H24N4O3S/c1-10(2)13(11-8-14-17(5)9-11)15-12(18)6-7-21(19,20)16(3)4/h8-10,13H,6-7H2,1-5H3,(H,15,18) |
| InChIKey | XMNLAMQVFNNOPP-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |