C14H18FN3O3S — CID 99830947
4-fluoro-3-methoxy-N-[(2S)-2-methyl-3-pyrazol-1-ylpropyl]benzenesulfonamide (PubChem CID 99830947) has the molecular formula C14H18FN3O3S and a molecular weight of 327.38 g/mol. Its IUPAC name is 4-fluoro-3-methoxy-N-[(2S)-2-methyl-3-pyrazol-1-ylpropyl]benzenesulfonamide.
| Compound Name | 4-fluoro-3-methoxy-N-[(2S)-2-methyl-3-pyrazol-1-ylpropyl]benzenesulfonamide |
|---|---|
| PubChem CID | 99830947 |
| Molecular Formula | C14H18FN3O3S |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.11 |
| IUPAC Name | 4-fluoro-3-methoxy-N-[(2S)-2-methyl-3-pyrazol-1-ylpropyl]benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)NC[C@@H](C)Cn2cccn2)ccc1F |
| InChI | InChI=1S/C14H18FN3O3S/c1-11(10-18-7-3-6-16-18)9-17-22(19,20)12-4-5-13(15)14(8-12)21-2/h3-8,11,17H,9-10H2,1-2H3/t11-/m1/s1 |
| InChIKey | UWQGLDAGGNZBBK-LLVKDONJSA-N |
| XLogP | 1.65 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |