C16H22FN3O2 — CID 99831235
3-[[(2S)-4-cyclopropylmorpholin-2-yl]methyl]-1-(4-fluorophenyl)-1-methylurea (PubChem CID 99831235) has the molecular formula C16H22FN3O2 and a molecular weight of 307.37 g/mol. Its IUPAC name is 3-[[(2S)-4-cyclopropylmorpholin-2-yl]methyl]-1-(4-fluorophenyl)-1-methylurea.
| Compound Name | 3-[[(2S)-4-cyclopropylmorpholin-2-yl]methyl]-1-(4-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 99831235 |
| Molecular Formula | C16H22FN3O2 |
| Molecular Weight | 307.37 g/mol |
| Exact Mass | 307.17 |
| IUPAC Name | 3-[[(2S)-4-cyclopropylmorpholin-2-yl]methyl]-1-(4-fluorophenyl)-1-methylurea |
| SMILES | CN(C(=O)NC[C@H]1CN(C2CC2)CCO1)c1ccc(F)cc1 |
| InChI | InChI=1S/C16H22FN3O2/c1-19(13-4-2-12(17)3-5-13)16(21)18-10-15-11-20(8-9-22-15)14-6-7-14/h2-5,14-15H,6-11H2,1H3,(H,18,21)/t15-/m0/s1 |
| InChIKey | KWUBTOXHJNUGOA-HNNXBMFYSA-N |
| XLogP | 1.83 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.37 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |