C17H24N2O3S — CID 99835245
4-[3-[[(7S)-7-methyl-1,1-dioxo-1,4-thiazepan-4-yl]methyl]phenoxy]butanenitrile (PubChem CID 99835245) has the molecular formula C17H24N2O3S and a molecular weight of 336.46 g/mol. Its IUPAC name is 4-[3-[[(7S)-7-methyl-1,1-dioxo-1,4-thiazepan-4-yl]methyl]phenoxy]butanenitrile.
| Compound Name | 4-[3-[[(7S)-7-methyl-1,1-dioxo-1,4-thiazepan-4-yl]methyl]phenoxy]butanenitrile |
|---|---|
| PubChem CID | 99835245 |
| Molecular Formula | C17H24N2O3S |
| Molecular Weight | 336.46 g/mol |
| Exact Mass | 336.15 |
| IUPAC Name | 4-[3-[[(7S)-7-methyl-1,1-dioxo-1,4-thiazepan-4-yl]methyl]phenoxy]butanenitrile |
| SMILES | C[C@H]1CCN(Cc2cccc(OCCCC#N)c2)CCS1(=O)=O |
| InChI | InChI=1S/C17H24N2O3S/c1-15-7-9-19(10-12-23(15,20)21)14-16-5-4-6-17(13-16)22-11-3-2-8-18/h4-6,13,15H,2-3,7,9-12,14H2,1H3/t15-/m0/s1 |
| InChIKey | HANFYMOEPFURRZ-HNNXBMFYSA-N |
| XLogP | 2.38 |
| TPSA | 70.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.46 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|