C11H24N2O2S — CID 99836162
N-[2-[[(1S,2S)-2,4,4-trimethylcyclopentyl]amino]ethyl]methanesulfonamide (PubChem CID 99836162) has the molecular formula C11H24N2O2S and a molecular weight of 248.39 g/mol. Its IUPAC name is N-[2-[[(1S,2S)-2,4,4-trimethylcyclopentyl]amino]ethyl]methanesulfonamide.
| Compound Name | N-[2-[[(1S,2S)-2,4,4-trimethylcyclopentyl]amino]ethyl]methanesulfonamide |
|---|---|
| PubChem CID | 99836162 |
| Molecular Formula | C11H24N2O2S |
| Molecular Weight | 248.39 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | N-[2-[[(1S,2S)-2,4,4-trimethylcyclopentyl]amino]ethyl]methanesulfonamide |
| SMILES | C[C@H]1CC(C)(C)C[C@@H]1NCCNS(C)(=O)=O |
| InChI | InChI=1S/C11H24N2O2S/c1-9-7-11(2,3)8-10(9)12-5-6-13-16(4,14)15/h9-10,12-13H,5-8H2,1-4H3/t9-,10-/m0/s1 |
| InChIKey | QCJNFUMGXVDQNH-UWVGGRQHSA-N |
| XLogP | 0.95 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.39 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|