C14H21BrN2O3 — CID 99836310
1-(4-bromo-3,5-dimethylphenyl)-3-[(3R)-3-hydroxy-4-methoxybutyl]urea (PubChem CID 99836310) has the molecular formula C14H21BrN2O3 and a molecular weight of 345.24 g/mol. Its IUPAC name is 1-(4-bromo-3,5-dimethylphenyl)-3-[(3R)-3-hydroxy-4-methoxybutyl]urea.
| Compound Name | 1-(4-bromo-3,5-dimethylphenyl)-3-[(3R)-3-hydroxy-4-methoxybutyl]urea |
|---|---|
| PubChem CID | 99836310 |
| Molecular Formula | C14H21BrN2O3 |
| Molecular Weight | 345.24 g/mol |
| Exact Mass | 344.07 |
| IUPAC Name | 1-(4-bromo-3,5-dimethylphenyl)-3-[(3R)-3-hydroxy-4-methoxybutyl]urea |
| SMILES | COC[C@H](O)CCNC(=O)Nc1cc(C)c(Br)c(C)c1 |
| InChI | InChI=1S/C14H21BrN2O3/c1-9-6-11(7-10(2)13(9)15)17-14(19)16-5-4-12(18)8-20-3/h6-7,12,18H,4-5,8H2,1-3H3,(H2,16,17,19)/t12-/m1/s1 |
| InChIKey | SATCKRCKOMSFDV-GFCCVEGCSA-N |
| XLogP | 2.58 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.24 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |