C15H19F4N3O2 — CID 99837002
4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide (PubChem CID 99837002) has the molecular formula C15H19F4N3O2 and a molecular weight of 349.33 g/mol. Its IUPAC name is 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide.
| Compound Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide |
|---|---|
| PubChem CID | 99837002 |
| Molecular Formula | C15H19F4N3O2 |
| Molecular Weight | 349.33 g/mol |
| Exact Mass | 349.14 |
| IUPAC Name | 4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]-N-(2,2,3,3-tetrafluoropropyl)pyridine-2-carboxamide |
| SMILES | C[C@H]1CN(c2ccnc(C(=O)NCC(F)(F)C(F)F)c2)C[C@H](C)O1 |
| InChI | InChI=1S/C15H19F4N3O2/c1-9-6-22(7-10(2)24-9)11-3-4-20-12(5-11)13(23)21-8-15(18,19)14(16)17/h3-5,9-10,14H,6-8H2,1-2H3,(H,21,23)/t9-,10-/m0/s1 |
| InChIKey | ITFWMVJMBQYCKH-UWVGGRQHSA-N |
| XLogP | 2.33 |
| TPSA | 54.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.33 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|