C17H23N3O2S — CID 99839345
6-[2-[benzyl(methyl)amino]ethylsulfanylmethyl]-1,3-dimethylpyrimidine-2,4-dione (PubChem CID 99839345) has the molecular formula C17H23N3O2S and a molecular weight of 333.46 g/mol. Its IUPAC name is 6-[2-[benzyl(methyl)amino]ethylsulfanylmethyl]-1,3-dimethylpyrimidine-2,4-dione.
| Compound Name | 6-[2-[benzyl(methyl)amino]ethylsulfanylmethyl]-1,3-dimethylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 99839345 |
| Molecular Formula | C17H23N3O2S |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | 6-[2-[benzyl(methyl)amino]ethylsulfanylmethyl]-1,3-dimethylpyrimidine-2,4-dione |
| SMILES | CN(CCSCc1cc(=O)n(C)c(=O)n1C)Cc1ccccc1 |
| InChI | InChI=1S/C17H23N3O2S/c1-18(12-14-7-5-4-6-8-14)9-10-23-13-15-11-16(21)20(3)17(22)19(15)2/h4-8,11H,9-10,12-13H2,1-3H3 |
| InChIKey | PREXMSOHQAVNRB-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 47.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|