C23H27N3O3 — CID 99841245
N-[(1-benzylpiperidin-4-yl)methyl]-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide (PubChem CID 99841245) has the molecular formula C23H27N3O3 and a molecular weight of 393.49 g/mol. Its IUPAC name is N-[(1-benzylpiperidin-4-yl)methyl]-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide.
| Compound Name | N-[(1-benzylpiperidin-4-yl)methyl]-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
|---|---|
| PubChem CID | 99841245 |
| Molecular Formula | C23H27N3O3 |
| Molecular Weight | 393.49 g/mol |
| Exact Mass | 393.21 |
| IUPAC Name | N-[(1-benzylpiperidin-4-yl)methyl]-3-(2-oxo-1,3-oxazolidin-3-yl)benzamide |
| SMILES | O=C(NCC1CCN(Cc2ccccc2)CC1)c1cccc(N2CCOC2=O)c1 |
| InChI | InChI=1S/C23H27N3O3/c27-22(20-7-4-8-21(15-20)26-13-14-29-23(26)28)24-16-18-9-11-25(12-10-18)17-19-5-2-1-3-6-19/h1-8,15,18H,9-14,16-17H2,(H,24,27) |
| InChIKey | OCQWQWVWRDMOIS-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 61.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.49 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |