C19H24N2O5 — CID 99845526
methyl 2-[(2S)-1-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]piperidin-2-yl]acetate (PubChem CID 99845526) has the molecular formula C19H24N2O5 and a molecular weight of 360.41 g/mol. Its IUPAC name is methyl 2-[(2S)-1-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]piperidin-2-yl]acetate.
| Compound Name | methyl 2-[(2S)-1-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]piperidin-2-yl]acetate |
|---|---|
| PubChem CID | 99845526 |
| Molecular Formula | C19H24N2O5 |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.17 |
| IUPAC Name | methyl 2-[(2S)-1-[2-[(1R,2S,6S,7S)-3,5-dioxo-4-azatricyclo[5.2.1.02,6]dec-8-en-4-yl]acetyl]piperidin-2-yl]acetate |
| SMILES | COC(=O)C[C@@H]1CCCCN1C(=O)CN1C(=O)[C@@H]2[C@@H](C1=O)[C@H]1C=C[C@@H]2C1 |
| InChI | InChI=1S/C19H24N2O5/c1-26-15(23)9-13-4-2-3-7-20(13)14(22)10-21-18(24)16-11-5-6-12(8-11)17(16)19(21)25/h5-6,11-13,16-17H,2-4,7-10H2,1H3/t11-,12+,13-,16-,17-/m0/s1 |
| InChIKey | JKRQPJJVYPCBRK-ZWRJDUBHSA-N |
| XLogP | 0.74 |
| TPSA | 83.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|