C15H23NO2 — CID 99849083
(3R)-N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]oxolan-3-amine (PubChem CID 99849083) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is (3R)-N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]oxolan-3-amine.
| Compound Name | (3R)-N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]oxolan-3-amine |
|---|---|
| PubChem CID | 99849083 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | (3R)-N-[(2S)-1-(2,6-dimethylphenoxy)propan-2-yl]oxolan-3-amine |
| SMILES | Cc1cccc(C)c1OC[C@H](C)N[C@@H]1CCOC1 |
| InChI | InChI=1S/C15H23NO2/c1-11-5-4-6-12(2)15(11)18-9-13(3)16-14-7-8-17-10-14/h4-6,13-14,16H,7-10H2,1-3H3/t13-,14+/m0/s1 |
| InChIKey | UMRAJVQOFCQEIN-UONOGXRCSA-N |
| XLogP | 2.45 |
| TPSA | 30.49 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |