C12H19NOS2 — CID 123873902
1-(2,6-dimethylphenoxy)-N-(methyldisulfanyl)propan-2-amine (PubChem CID 123873902) has the molecular formula C12H19NOS2 and a molecular weight of 257.42 g/mol. Its IUPAC name is 1-(2,6-dimethylphenoxy)-N-(methyldisulfanyl)propan-2-amine.
| Compound Name | 1-(2,6-dimethylphenoxy)-N-(methyldisulfanyl)propan-2-amine |
|---|---|
| PubChem CID | 123873902 |
| Molecular Formula | C12H19NOS2 |
| Molecular Weight | 257.42 g/mol |
| Exact Mass | 257.09 |
| IUPAC Name | 1-(2,6-dimethylphenoxy)-N-(methyldisulfanyl)propan-2-amine |
| SMILES | CSSNC(C)COc1c(C)cccc1C |
| InChI | InChI=1S/C12H19NOS2/c1-9-6-5-7-10(2)12(9)14-8-11(3)13-16-15-4/h5-7,11,13H,8H2,1-4H3 |
| InChIKey | PBUDGFHLXHSTIH-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.42 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|