C15H25NO — CID 99849214
(4S)-4-[[(1S)-1-(2,3-dimethylphenyl)ethyl]amino]pentan-1-ol (PubChem CID 99849214) has the molecular formula C15H25NO and a molecular weight of 235.37 g/mol. Its IUPAC name is (4S)-4-[[(1S)-1-(2,3-dimethylphenyl)ethyl]amino]pentan-1-ol.
| Compound Name | (4S)-4-[[(1S)-1-(2,3-dimethylphenyl)ethyl]amino]pentan-1-ol |
|---|---|
| PubChem CID | 99849214 |
| Molecular Formula | C15H25NO |
| Molecular Weight | 235.37 g/mol |
| Exact Mass | 235.19 |
| IUPAC Name | (4S)-4-[[(1S)-1-(2,3-dimethylphenyl)ethyl]amino]pentan-1-ol |
| SMILES | Cc1cccc([C@H](C)N[C@@H](C)CCCO)c1C |
| InChI | InChI=1S/C15H25NO/c1-11-7-5-9-15(13(11)3)14(4)16-12(2)8-6-10-17/h5,7,9,12,14,16-17H,6,8,10H2,1-4H3/t12-,14-/m0/s1 |
| InChIKey | LBPJKSQKEQGRLY-JSGCOSHPSA-N |
| XLogP | 3.12 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.37 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |