C12H19NO3 — CID 99851184
5-[[(1S,2R)-2-cyclopropylcyclopropanecarbonyl]amino]pentanoic acid (PubChem CID 99851184) has the molecular formula C12H19NO3 and a molecular weight of 225.29 g/mol. Its IUPAC name is 5-[[(1S,2R)-2-cyclopropylcyclopropanecarbonyl]amino]pentanoic acid.
| Compound Name | 5-[[(1S,2R)-2-cyclopropylcyclopropanecarbonyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 99851184 |
| Molecular Formula | C12H19NO3 |
| Molecular Weight | 225.29 g/mol |
| Exact Mass | 225.14 |
| IUPAC Name | 5-[[(1S,2R)-2-cyclopropylcyclopropanecarbonyl]amino]pentanoic acid |
| SMILES | O=C(O)CCCCNC(=O)[C@H]1C[C@@H]1C1CC1 |
| InChI | InChI=1S/C12H19NO3/c14-11(15)3-1-2-6-13-12(16)10-7-9(10)8-4-5-8/h8-10H,1-7H2,(H,13,16)(H,14,15)/t9-,10+/m1/s1 |
| InChIKey | NROVRJWVBIBZHY-ZJUUUORDSA-N |
| XLogP | 1.40 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.29 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|