C26H37N3O4 — CID 99851215
1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-[2-methoxy-4-[(Z)-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]methyl]phenoxy]ethanone (PubChem CID 99851215) has the molecular formula C26H37N3O4 and a molecular weight of 455.60 g/mol. Its IUPAC name is 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-[2-methoxy-4-[(Z)-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]methyl]phenoxy]ethanone.
| Compound Name | 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-[2-methoxy-4-[(Z)-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]methyl]phenoxy]ethanone |
|---|---|
| PubChem CID | 99851215 |
| Molecular Formula | C26H37N3O4 |
| Molecular Weight | 455.60 g/mol |
| Exact Mass | 455.28 |
| IUPAC Name | 1-[(2S,6R)-2,6-dimethylmorpholin-4-yl]-2-[2-methoxy-4-[(Z)-[(E)-[(1S,4R)-1,7,7-trimethyl-2-bicyclo[2.2.1]heptanylidene]hydrazinylidene]methyl]phenoxy]ethanone |
| SMILES | COc1cc(/C=N\N=C2/C[C@H]3CC[C@@]2(C)C3(C)C)ccc1OCC(=O)N1C[C@@H](C)O[C@@H](C)C1 |
| InChI | InChI=1S/C26H37N3O4/c1-17-14-29(15-18(2)33-17)24(30)16-32-21-8-7-19(11-22(21)31-6)13-27-28-23-12-20-9-10-26(23,5)25(20,3)4/h7-8,11,13,17-18,20H,9-10,12,14-16H2,1-6H3/b27-13-,28-23+/t17-,18+,20-,26-/m1/s1 |
| InChIKey | NIBRQWLUQHXOSY-MEBMBJLASA-N |
| XLogP | 4.33 |
| TPSA | 72.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.60 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|