C16H22FN3O — CID 99852141
(2R)-1-[[(1S)-1-(2-fluorophenyl)propyl]amino]-2-(1-methylpyrazol-4-yl)propan-2-ol (PubChem CID 99852141) has the molecular formula C16H22FN3O and a molecular weight of 291.37 g/mol. Its IUPAC name is (2R)-1-[[(1S)-1-(2-fluorophenyl)propyl]amino]-2-(1-methylpyrazol-4-yl)propan-2-ol.
| Compound Name | (2R)-1-[[(1S)-1-(2-fluorophenyl)propyl]amino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
|---|---|
| PubChem CID | 99852141 |
| Molecular Formula | C16H22FN3O |
| Molecular Weight | 291.37 g/mol |
| Exact Mass | 291.17 |
| IUPAC Name | (2R)-1-[[(1S)-1-(2-fluorophenyl)propyl]amino]-2-(1-methylpyrazol-4-yl)propan-2-ol |
| SMILES | CC[C@H](NC[C@](C)(O)c1cnn(C)c1)c1ccccc1F |
| InChI | InChI=1S/C16H22FN3O/c1-4-15(13-7-5-6-8-14(13)17)18-11-16(2,21)12-9-19-20(3)10-12/h5-10,15,18,21H,4,11H2,1-3H3/t15-,16-/m0/s1 |
| InChIKey | IZVGYOJIBOBNFI-HOTGVXAUSA-N |
| XLogP | 2.51 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.37 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |