C19H28N4O2 — CID 97232685
(3S)-N-(2-ethylphenyl)-3-[[(2R)-2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]butanamide (PubChem CID 97232685) has the molecular formula C19H28N4O2 and a molecular weight of 344.46 g/mol. Its IUPAC name is (3S)-N-(2-ethylphenyl)-3-[[(2R)-2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]butanamide.
| Compound Name | (3S)-N-(2-ethylphenyl)-3-[[(2R)-2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]butanamide |
|---|---|
| PubChem CID | 97232685 |
| Molecular Formula | C19H28N4O2 |
| Molecular Weight | 344.46 g/mol |
| Exact Mass | 344.22 |
| IUPAC Name | (3S)-N-(2-ethylphenyl)-3-[[(2R)-2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]amino]butanamide |
| SMILES | CCc1ccccc1NC(=O)C[C@H](C)NC[C@](C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C19H28N4O2/c1-5-15-8-6-7-9-17(15)22-18(24)10-14(2)20-13-19(3,25)16-11-21-23(4)12-16/h6-9,11-12,14,20,25H,5,10,13H2,1-4H3,(H,22,24)/t14-,19-/m0/s1 |
| InChIKey | OUFHWUPEANRFGN-LIRRHRJNSA-N |
| XLogP | 2.20 |
| TPSA | 79.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.46 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |