C14H25N3O2S — CID 111458559
2-butylsulfanyl-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide (PubChem CID 111458559) has the molecular formula C14H25N3O2S and a molecular weight of 299.44 g/mol. Its IUPAC name is 2-butylsulfanyl-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide.
| Compound Name | 2-butylsulfanyl-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide |
|---|---|
| PubChem CID | 111458559 |
| Molecular Formula | C14H25N3O2S |
| Molecular Weight | 299.44 g/mol |
| Exact Mass | 299.17 |
| IUPAC Name | 2-butylsulfanyl-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide |
| SMILES | CCCCSC(C)C(=O)NCC(C)(O)c1cnn(C)c1 |
| InChI | InChI=1S/C14H25N3O2S/c1-5-6-7-20-11(2)13(18)15-10-14(3,19)12-8-16-17(4)9-12/h8-9,11,19H,5-7,10H2,1-4H3,(H,15,18) |
| InChIKey | DBFWDCWRIPZFOI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.44 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|