C15H19N3O2S — CID 111458525
N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-phenylsulfanylacetamide (PubChem CID 111458525) has the molecular formula C15H19N3O2S and a molecular weight of 305.40 g/mol. Its IUPAC name is N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-phenylsulfanylacetamide.
| Compound Name | N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-phenylsulfanylacetamide |
|---|---|
| PubChem CID | 111458525 |
| Molecular Formula | C15H19N3O2S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]-2-phenylsulfanylacetamide |
| SMILES | Cn1cc(C(C)(O)CNC(=O)CSc2ccccc2)cn1 |
| InChI | InChI=1S/C15H19N3O2S/c1-15(20,12-8-17-18(2)9-12)11-16-14(19)10-21-13-6-4-3-5-7-13/h3-9,20H,10-11H2,1-2H3,(H,16,19) |
| InChIKey | UFSIPCVGFYMDQP-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |