C16H20ClN3O3 — CID 111519834
3-(2-chlorophenoxy)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide (PubChem CID 111519834) has the molecular formula C16H20ClN3O3 and a molecular weight of 337.81 g/mol. Its IUPAC name is 3-(2-chlorophenoxy)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide.
| Compound Name | 3-(2-chlorophenoxy)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide |
|---|---|
| PubChem CID | 111519834 |
| Molecular Formula | C16H20ClN3O3 |
| Molecular Weight | 337.81 g/mol |
| Exact Mass | 337.12 |
| IUPAC Name | 3-(2-chlorophenoxy)-N-[2-hydroxy-2-(1-methylpyrazol-4-yl)propyl]propanamide |
| SMILES | Cn1cc(C(C)(O)CNC(=O)CCOc2ccccc2Cl)cn1 |
| InChI | InChI=1S/C16H20ClN3O3/c1-16(22,12-9-19-20(2)10-12)11-18-15(21)7-8-23-14-6-4-3-5-13(14)17/h3-6,9-10,22H,7-8,11H2,1-2H3,(H,18,21) |
| InChIKey | PATJYVPAXXBBMZ-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.81 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |