C14H19ClFNO2S — CID 99853452
N-[(1S)-1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-3-[(R)-methylsulfinyl]propanamide (PubChem CID 99853452) has the molecular formula C14H19ClFNO2S and a molecular weight of 319.83 g/mol. Its IUPAC name is N-[(1S)-1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-3-[(R)-methylsulfinyl]propanamide.
| Compound Name | N-[(1S)-1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-3-[(R)-methylsulfinyl]propanamide |
|---|---|
| PubChem CID | 99853452 |
| Molecular Formula | C14H19ClFNO2S |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.08 |
| IUPAC Name | N-[(1S)-1-(4-chloro-2-fluorophenyl)-2-methylpropyl]-3-[(R)-methylsulfinyl]propanamide |
| SMILES | CC(C)[C@H](NC(=O)CC[S@@](C)=O)c1ccc(Cl)cc1F |
| InChI | InChI=1S/C14H19ClFNO2S/c1-9(2)14(17-13(18)6-7-20(3)19)11-5-4-10(15)8-12(11)16/h4-5,8-9,14H,6-7H2,1-3H3,(H,17,18)/t14-,20+/m0/s1 |
| InChIKey | ODWVQSPKUVEVBB-VBKZILBWSA-N |
| XLogP | 3.06 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |