C14H18ClFN2O3 — CID 75476390
methyl N-[2-[[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]amino]-2-oxoethyl]carbamate (PubChem CID 75476390) has the molecular formula C14H18ClFN2O3 and a molecular weight of 316.76 g/mol. Its IUPAC name is methyl N-[2-[[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]amino]-2-oxoethyl]carbamate.
| Compound Name | methyl N-[2-[[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 75476390 |
| Molecular Formula | C14H18ClFN2O3 |
| Molecular Weight | 316.76 g/mol |
| Exact Mass | 316.10 |
| IUPAC Name | methyl N-[2-[[1-(4-chloro-2-fluorophenyl)-2-methylpropyl]amino]-2-oxoethyl]carbamate |
| SMILES | COC(=O)NCC(=O)NC(c1ccc(Cl)cc1F)C(C)C |
| InChI | InChI=1S/C14H18ClFN2O3/c1-8(2)13(10-5-4-9(15)6-11(10)16)18-12(19)7-17-14(20)21-3/h4-6,8,13H,7H2,1-3H3,(H,17,20)(H,18,19) |
| InChIKey | NFFRXNNSEWVIBU-UHFFFAOYSA-N |
| XLogP | 2.65 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.76 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |