C19H20Cl2FNO3 — CID 123612353
tert-butyl N-[1-(4-chloro-2-fluorophenyl)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate (PubChem CID 123612353) has the molecular formula C19H20Cl2FNO3 and a molecular weight of 400.28 g/mol. Its IUPAC name is tert-butyl N-[1-(4-chloro-2-fluorophenyl)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate.
| Compound Name | tert-butyl N-[1-(4-chloro-2-fluorophenyl)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
|---|---|
| PubChem CID | 123612353 |
| Molecular Formula | C19H20Cl2FNO3 |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.08 |
| IUPAC Name | tert-butyl N-[1-(4-chloro-2-fluorophenyl)-2-(3-chlorophenyl)-2-hydroxyethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC(c1ccc(Cl)cc1F)C(O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C19H20Cl2FNO3/c1-19(2,3)26-18(25)23-16(14-8-7-13(21)10-15(14)22)17(24)11-5-4-6-12(20)9-11/h4-10,16-17,24H,1-3H3,(H,23,25) |
| InChIKey | MEZDFRJFACPAHY-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |