C22H24BrCl2NO4 — CID 90341891
tert-butyl 3-bromo-4-[[(1R,2R)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]-4-oxobutanoate (PubChem CID 90341891) has the molecular formula C22H24BrCl2NO4 and a molecular weight of 517.25 g/mol. Its IUPAC name is tert-butyl 3-bromo-4-[[(1R,2R)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]-4-oxobutanoate.
| Compound Name | tert-butyl 3-bromo-4-[[(1R,2R)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 90341891 |
| Molecular Formula | C22H24BrCl2NO4 |
| Molecular Weight | 517.25 g/mol |
| Exact Mass | 515.03 |
| IUPAC Name | tert-butyl 3-bromo-4-[[(1R,2R)-2-(3-chlorophenyl)-1-(4-chlorophenyl)-2-hydroxyethyl]amino]-4-oxobutanoate |
| SMILES | CC(C)(C)OC(=O)CC(Br)C(=O)N[C@H](c1ccc(Cl)cc1)[C@H](O)c1cccc(Cl)c1 |
| InChI | InChI=1S/C22H24BrCl2NO4/c1-22(2,3)30-18(27)12-17(23)21(29)26-19(13-7-9-15(24)10-8-13)20(28)14-5-4-6-16(25)11-14/h4-11,17,19-20,28H,12H2,1-3H3,(H,26,29)/t17?,19-,20-/m1/s1 |
| InChIKey | UHGFRLMKJLNRHZ-IPNZSQQUSA-N |
| XLogP | 5.38 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.25 |
| LogP ≤ 5 | 5.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|