C19H23N5O — CID 99854148
(2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(quinolin-2-ylamino)ethyl]propanamide (PubChem CID 99854148) has the molecular formula C19H23N5O and a molecular weight of 337.43 g/mol. Its IUPAC name is (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(quinolin-2-ylamino)ethyl]propanamide.
| Compound Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(quinolin-2-ylamino)ethyl]propanamide |
|---|---|
| PubChem CID | 99854148 |
| Molecular Formula | C19H23N5O |
| Molecular Weight | 337.43 g/mol |
| Exact Mass | 337.19 |
| IUPAC Name | (2S)-2-(3,5-dimethyl-1H-pyrazol-4-yl)-N-[2-(quinolin-2-ylamino)ethyl]propanamide |
| SMILES | Cc1n[nH]c(C)c1[C@H](C)C(=O)NCCNc1ccc2ccccc2n1 |
| InChI | InChI=1S/C19H23N5O/c1-12(18-13(2)23-24-14(18)3)19(25)21-11-10-20-17-9-8-15-6-4-5-7-16(15)22-17/h4-9,12H,10-11H2,1-3H3,(H,20,22)(H,21,25)(H,23,24)/t12-/m0/s1 |
| InChIKey | VZPVKZMBTNDROA-LBPRGKRZSA-N |
| XLogP | 2.91 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.43 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|