C18H17FN2O2 — CID 99854295
(1S)-2-[[(R)-(5-fluoro-2-pyridinyl)-phenylmethyl]amino]-1-(furan-2-yl)ethanol (PubChem CID 99854295) has the molecular formula C18H17FN2O2 and a molecular weight of 312.34 g/mol. Its IUPAC name is (1S)-2-[[(R)-(5-fluoro-2-pyridinyl)-phenylmethyl]amino]-1-(furan-2-yl)ethanol.
| Compound Name | (1S)-2-[[(R)-(5-fluoro-2-pyridinyl)-phenylmethyl]amino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 99854295 |
| Molecular Formula | C18H17FN2O2 |
| Molecular Weight | 312.34 g/mol |
| Exact Mass | 312.13 |
| IUPAC Name | (1S)-2-[[(R)-(5-fluoro-2-pyridinyl)-phenylmethyl]amino]-1-(furan-2-yl)ethanol |
| SMILES | O[C@@H](CN[C@H](c1ccccc1)c1ccc(F)cn1)c1ccco1 |
| InChI | InChI=1S/C18H17FN2O2/c19-14-8-9-15(20-11-14)18(13-5-2-1-3-6-13)21-12-16(22)17-7-4-10-23-17/h1-11,16,18,21-22H,12H2/t16-,18+/m0/s1 |
| InChIKey | UZMCAPVSEXKTNH-FUHWJXTLSA-N |
| XLogP | 3.23 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.34 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |