C14H17FN2O2 — CID 110010180
2-[1-(5-fluoro-2-pyridinyl)propylamino]-1-(furan-2-yl)ethanol (PubChem CID 110010180) has the molecular formula C14H17FN2O2 and a molecular weight of 264.30 g/mol. Its IUPAC name is 2-[1-(5-fluoro-2-pyridinyl)propylamino]-1-(furan-2-yl)ethanol.
| Compound Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]-1-(furan-2-yl)ethanol |
|---|---|
| PubChem CID | 110010180 |
| Molecular Formula | C14H17FN2O2 |
| Molecular Weight | 264.30 g/mol |
| Exact Mass | 264.13 |
| IUPAC Name | 2-[1-(5-fluoro-2-pyridinyl)propylamino]-1-(furan-2-yl)ethanol |
| SMILES | CCC(NCC(O)c1ccco1)c1ccc(F)cn1 |
| InChI | InChI=1S/C14H17FN2O2/c1-2-11(12-6-5-10(15)8-16-12)17-9-13(18)14-4-3-7-19-14/h3-8,11,13,17-18H,2,9H2,1H3 |
| InChIKey | LIDDGFNNFLBLBX-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 58.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.30 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |