C12H21BO4 — CID 99866892
cis-ethyl (1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate (PubChem CID 99866892) has the molecular formula C12H21BO4 and a molecular weight of 240.11 g/mol. Its IUPAC name is cis-ethyl (1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate.
| Compound Name | cis-ethyl (1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate |
|---|---|
| PubChem CID | 99866892 |
| Molecular Formula | C12H21BO4 |
| Molecular Weight | 240.11 g/mol |
| Exact Mass | 240.15 |
| IUPAC Name | cis-ethyl (1S,2R)-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclopropane-1-carboxylate |
| SMILES | CCOC(=O)[C@H]1C[C@H]1B1OC(C)(C)C(C)(C)O1 |
| InChI | InChI=1S/C12H21BO4/c1-6-15-10(14)8-7-9(8)13-16-11(2,3)12(4,5)17-13/h8-9H,6-7H2,1-5H3/t8-,9+/m0/s1 |
| InChIKey | AAORUCVESAXSRS-DTWKUNHWSA-N |
| XLogP | 2.03 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.11 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|