C10H11Br — CID 99867115
1-bromo-2-[(1S,2S)-2-methylcyclopropyl]benzene (PubChem CID 99867115) has the molecular formula C10H11Br and a molecular weight of 211.10 g/mol. Its IUPAC name is 1-bromo-2-[(1S,2S)-2-methylcyclopropyl]benzene.
| Compound Name | 1-bromo-2-[(1S,2S)-2-methylcyclopropyl]benzene |
|---|---|
| PubChem CID | 99867115 |
| Molecular Formula | C10H11Br |
| Molecular Weight | 211.10 g/mol |
| Exact Mass | 210.00 |
| IUPAC Name | 1-bromo-2-[(1S,2S)-2-methylcyclopropyl]benzene |
| SMILES | C[C@H]1C[C@@H]1c1ccccc1Br |
| InChI | InChI=1S/C10H11Br/c1-7-6-9(7)8-4-2-3-5-10(8)11/h2-5,7,9H,6H2,1H3/t7-,9-/m0/s1 |
| InChIKey | KVLWOYUWAXSOHG-CBAPKCEASA-N |
| XLogP | 3.57 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.10 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |