About (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene
(9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene (PubChem CID 140882379) has the molecular formula C12H14
and a molecular weight of 158.24 g/mol. Its IUPAC name is (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene.
Analyze (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The IUPAC name of (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene (CID 140882379) is (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene.
What is the SMILES notation for (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The canonical SMILES for (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene is C[C@H]1CC2CC1c1ccccc12.
What is the InChIKey of (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene?
The InChIKey is GYMYDNQFUUNWOU-QTZUAFFRSA-N. The full InChI is InChI=1S/C12H14/c1-8-6-9-7-12(8)11-5-3-2-4-10(9)11/h2-5,8-9,12H,6-7H2,1H3/t8-,9?,12?/m0/s1.
What are the key properties of (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene?
(9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene has a molecular weight of 158.24 g/mol, XLogP of 3.30, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (9S)-9-methyltricyclo[6.2.1.02,7]undeca-2,4,6-triene is sourced from PubChem (CID 140882379), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).