C12H11BrO — CID 134893539
(1S,8S,9R)-9-bromotricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one (PubChem CID 134893539) has the molecular formula C12H11BrO and a molecular weight of 251.12 g/mol. Its IUPAC name is (1S,8S,9R)-9-bromotricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one.
| Compound Name | (1S,8S,9R)-9-bromotricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one |
|---|---|
| PubChem CID | 134893539 |
| Molecular Formula | C12H11BrO |
| Molecular Weight | 251.12 g/mol |
| Exact Mass | 250.00 |
| IUPAC Name | (1S,8S,9R)-9-bromotricyclo[6.3.1.02,7]dodeca-2,4,6-trien-10-one |
| SMILES | O=C1C[C@@H]2C[C@@H](c3ccccc32)[C@H]1Br |
| InChI | InChI=1S/C12H11BrO/c13-12-10-5-7(6-11(12)14)8-3-1-2-4-9(8)10/h1-4,7,10,12H,5-6H2/t7-,10-,12+/m0/s1 |
| InChIKey | PRPGUWNNDXNOHC-VIRWGQHYSA-N |
| XLogP | 2.99 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.12 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|