C9H18N2O — CID 99868084
4-[(2R,3S)-2-methylpyrrolidin-3-yl]morpholine (PubChem CID 99868084) has the molecular formula C9H18N2O and a molecular weight of 170.26 g/mol. Its IUPAC name is 4-[(2R,3S)-2-methylpyrrolidin-3-yl]morpholine.
| Compound Name | 4-[(2R,3S)-2-methylpyrrolidin-3-yl]morpholine |
|---|---|
| PubChem CID | 99868084 |
| Molecular Formula | C9H18N2O |
| Molecular Weight | 170.26 g/mol |
| Exact Mass | 170.14 |
| IUPAC Name | 4-[(2R,3S)-2-methylpyrrolidin-3-yl]morpholine |
| SMILES | C[C@H]1NCC[C@@H]1N1CCOCC1 |
| InChI | InChI=1S/C9H18N2O/c1-8-9(2-3-10-8)11-4-6-12-7-5-11/h8-10H,2-7H2,1H3/t8-,9+/m1/s1 |
| InChIKey | ZEIFKQPBVWHIHZ-BDAKNGLRSA-N |
| XLogP | 0.07 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 170.26 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |