About N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide
N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide (PubChem CID 99873860) has the molecular formula C14H17N3O3
and a molecular weight of 275.31 g/mol. Its IUPAC name is N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide.
Molecular Properties
| Compound Name | N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide |
| PubChem CID | 99873860 |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.31 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide |
| SMILES | O=C1NCCN1C(=O)NC[C@]1(O)CCc2ccccc21 |
| InChI | InChI=1S/C14H17N3O3/c18-12-15-7-8-17(12)13(19)16-9-14(20)6-5-10-3-1-2-4-11(10)14/h1-4,20H,5-9H2,(H,15,18)(H,16,19)/t14-/m1/s1 |
| InChIKey | LZSNSLZDJJCZKD-CQSZACIVSA-N |
| XLogP | 0.56 |
| TPSA | 81.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.31 |
| LogP ≤ 5 | 0.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide?
The IUPAC name of N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide (CID 99873860) is N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide.
What is the SMILES notation for N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide?
The canonical SMILES for N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide is O=C1NCCN1C(=O)NC[C@]1(O)CCc2ccccc21.
What is the InChIKey of N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide?
The InChIKey is LZSNSLZDJJCZKD-CQSZACIVSA-N. The full InChI is InChI=1S/C14H17N3O3/c18-12-15-7-8-17(12)13(19)16-9-14(20)6-5-10-3-1-2-4-11(10)14/h1-4,20H,5-9H2,(H,15,18)(H,16,19)/t14-/m1/s1.
What are the key properties of N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide?
N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide has a molecular weight of 275.31 g/mol, XLogP of 0.56, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[(1S)-1-hydroxy-2,3-dihydroinden-1-yl]methyl]-2-oxoimidazolidine-1-carboxamide is sourced from PubChem (CID 99873860), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).