C15H15F2NO4S — CID 99874030
2-(difluoromethylsulfonyl)-N-[(2S)-1-(furan-3-yl)propan-2-yl]benzamide (PubChem CID 99874030) has the molecular formula C15H15F2NO4S and a molecular weight of 343.35 g/mol. Its IUPAC name is 2-(difluoromethylsulfonyl)-N-[(2S)-1-(furan-3-yl)propan-2-yl]benzamide.
| Compound Name | 2-(difluoromethylsulfonyl)-N-[(2S)-1-(furan-3-yl)propan-2-yl]benzamide |
|---|---|
| PubChem CID | 99874030 |
| Molecular Formula | C15H15F2NO4S |
| Molecular Weight | 343.35 g/mol |
| Exact Mass | 343.07 |
| IUPAC Name | 2-(difluoromethylsulfonyl)-N-[(2S)-1-(furan-3-yl)propan-2-yl]benzamide |
| SMILES | C[C@@H](Cc1ccoc1)NC(=O)c1ccccc1S(=O)(=O)C(F)F |
| InChI | InChI=1S/C15H15F2NO4S/c1-10(8-11-6-7-22-9-11)18-14(19)12-4-2-3-5-13(12)23(20,21)15(16)17/h2-7,9-10,15H,8H2,1H3,(H,18,19)/t10-/m0/s1 |
| InChIKey | DGESAQLRSLIKGS-JTQLQIEISA-N |
| XLogP | 2.64 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.35 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |