C23H28FNO4S — CID 99882953
1-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-(4-propoxyphenyl)propan-1-one (PubChem CID 99882953) has the molecular formula C23H28FNO4S and a molecular weight of 433.55 g/mol. Its IUPAC name is 1-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-(4-propoxyphenyl)propan-1-one.
| Compound Name | 1-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-(4-propoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 99882953 |
| Molecular Formula | C23H28FNO4S |
| Molecular Weight | 433.55 g/mol |
| Exact Mass | 433.17 |
| IUPAC Name | 1-[(3S)-3-(4-fluorophenyl)sulfonylpiperidin-1-yl]-3-(4-propoxyphenyl)propan-1-one |
| SMILES | CCCOc1ccc(CCC(=O)N2CCC[C@H](S(=O)(=O)c3ccc(F)cc3)C2)cc1 |
| InChI | InChI=1S/C23H28FNO4S/c1-2-16-29-20-10-5-18(6-11-20)7-14-23(26)25-15-3-4-22(17-25)30(27,28)21-12-8-19(24)9-13-21/h5-6,8-13,22H,2-4,7,14-17H2,1H3/t22-/m0/s1 |
| InChIKey | MIWYBCDASBIUHL-QFIPXVFZSA-N |
| XLogP | 4.01 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.55 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |