C24H27NO3 — CID 99883658
1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-3-(4-methoxy-3-phenylmethoxyphenyl)propan-1-one (PubChem CID 99883658) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-3-(4-methoxy-3-phenylmethoxyphenyl)propan-1-one.
| Compound Name | 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-3-(4-methoxy-3-phenylmethoxyphenyl)propan-1-one |
|---|---|
| PubChem CID | 99883658 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | 1-[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-3-(4-methoxy-3-phenylmethoxyphenyl)propan-1-one |
| SMILES | COc1ccc(CCC(=O)N2[C@H]3CC=C[C@H]2CC3)cc1OCc1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-27-22-14-10-18(16-23(22)28-17-19-6-3-2-4-7-19)11-15-24(26)25-20-8-5-9-21(25)13-12-20/h2-8,10,14,16,20-21H,9,11-13,15,17H2,1H3/t20-,21-/m0/s1 |
| InChIKey | IUFUUMFVSBNUAE-SFTDATJTSA-N |
| XLogP | 4.53 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|