C24H27N3O — CID 99885339
(4E)-5-methyl-2-phenyl-4-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]pyrazol-3-one (PubChem CID 99885339) has the molecular formula C24H27N3O and a molecular weight of 373.50 g/mol. Its IUPAC name is (4E)-5-methyl-2-phenyl-4-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]pyrazol-3-one.
| Compound Name | (4E)-5-methyl-2-phenyl-4-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]pyrazol-3-one |
|---|---|
| PubChem CID | 99885339 |
| Molecular Formula | C24H27N3O |
| Molecular Weight | 373.50 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | (4E)-5-methyl-2-phenyl-4-[[(4S)-1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl]methylidene]pyrazol-3-one |
| SMILES | CC1=NN(c2ccccc2)C(=O)/C1=C/c1ccc2c(c1)[C@@H](C)CC(C)(C)N2C |
| InChI | InChI=1S/C24H27N3O/c1-16-15-24(3,4)26(5)22-12-11-18(13-20(16)22)14-21-17(2)25-27(23(21)28)19-9-7-6-8-10-19/h6-14,16H,15H2,1-5H3/b21-14+/t16-/m0/s1 |
| InChIKey | OCPRNOKEFVYFMY-YIRPMMGJSA-N |
| XLogP | 5.21 |
| TPSA | 35.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.50 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_five_het_A(201)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|