C24H28N2O — CID 58795373
(3Z)-1-ethyl-3-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]indol-2-one (PubChem CID 58795373) has the molecular formula C24H28N2O and a molecular weight of 360.50 g/mol. Its IUPAC name is (3Z)-1-ethyl-3-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]indol-2-one.
| Compound Name | (3Z)-1-ethyl-3-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]indol-2-one |
|---|---|
| PubChem CID | 58795373 |
| Molecular Formula | C24H28N2O |
| Molecular Weight | 360.50 g/mol |
| Exact Mass | 360.22 |
| IUPAC Name | (3Z)-1-ethyl-3-[(1,2,2,4-tetramethyl-3,4-dihydroquinolin-6-yl)methylidene]indol-2-one |
| SMILES | CCN1C(=O)/C(=C\c2ccc3c(c2)C(C)CC(C)(C)N3C)c2ccccc21 |
| InChI | InChI=1S/C24H28N2O/c1-6-26-22-10-8-7-9-18(22)20(23(26)27)14-17-11-12-21-19(13-17)16(2)15-24(3,4)25(21)5/h7-14,16H,6,15H2,1-5H3/b20-14- |
| InChIKey | AXSXOIPJGHHDMP-ZHZULCJRSA-N |
| XLogP | 5.32 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.50 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|