C19H23N3O — CID 99887437
(Z)-2-cyano-N-methyl-3-(1,2,2,4,7-pentamethylquinolin-6-yl)prop-2-enamide (PubChem CID 99887437) has the molecular formula C19H23N3O and a molecular weight of 309.41 g/mol. Its IUPAC name is (Z)-2-cyano-N-methyl-3-(1,2,2,4,7-pentamethylquinolin-6-yl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-methyl-3-(1,2,2,4,7-pentamethylquinolin-6-yl)prop-2-enamide |
|---|---|
| PubChem CID | 99887437 |
| Molecular Formula | C19H23N3O |
| Molecular Weight | 309.41 g/mol |
| Exact Mass | 309.18 |
| IUPAC Name | (Z)-2-cyano-N-methyl-3-(1,2,2,4,7-pentamethylquinolin-6-yl)prop-2-enamide |
| SMILES | CNC(=O)/C(C#N)=C\c1cc2c(cc1C)N(C)C(C)(C)C=C2C |
| InChI | InChI=1S/C19H23N3O/c1-12-7-17-16(13(2)10-19(3,4)22(17)6)9-14(12)8-15(11-20)18(23)21-5/h7-10H,1-6H3,(H,21,23)/b15-8- |
| InChIKey | BSCATTLJUYXBJA-NVNXTCNLSA-N |
| XLogP | 3.28 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.41 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|