C23H17BrN2O2S2 — CID 99902153
(5E)-5-[(4-bromophenyl)methylidene]-3-[(4-phenoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 99902153) has the molecular formula C23H17BrN2O2S2 and a molecular weight of 497.44 g/mol. Its IUPAC name is (5E)-5-[(4-bromophenyl)methylidene]-3-[(4-phenoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-5-[(4-bromophenyl)methylidene]-3-[(4-phenoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99902153 |
| Molecular Formula | C23H17BrN2O2S2 |
| Molecular Weight | 497.44 g/mol |
| Exact Mass | 495.99 |
| IUPAC Name | (5E)-5-[(4-bromophenyl)methylidene]-3-[(4-phenoxyanilino)methyl]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2ccc(Br)cc2)SC(=S)N1CNc1ccc(Oc2ccccc2)cc1 |
| InChI | InChI=1S/C23H17BrN2O2S2/c24-17-8-6-16(7-9-17)14-21-22(27)26(23(29)30-21)15-25-18-10-12-20(13-11-18)28-19-4-2-1-3-5-19/h1-14,25H,15H2/b21-14+ |
| InChIKey | JCTPKOOMZFWYPD-KGENOOAVSA-N |
| XLogP | 6.51 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.44 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|