C21H22BrN3OS2 — CID 99902744
(5E)-3-[(4-bromoanilino)methyl]-5-[[4-(diethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 99902744) has the molecular formula C21H22BrN3OS2 and a molecular weight of 476.47 g/mol. Its IUPAC name is (5E)-3-[(4-bromoanilino)methyl]-5-[[4-(diethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-[(4-bromoanilino)methyl]-5-[[4-(diethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 99902744 |
| Molecular Formula | C21H22BrN3OS2 |
| Molecular Weight | 476.47 g/mol |
| Exact Mass | 475.04 |
| IUPAC Name | (5E)-3-[(4-bromoanilino)methyl]-5-[[4-(diethylamino)phenyl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)c1ccc(/C=C2/SC(=S)N(CNc3ccc(Br)cc3)C2=O)cc1 |
| InChI | InChI=1S/C21H22BrN3OS2/c1-3-24(4-2)18-11-5-15(6-12-18)13-19-20(26)25(21(27)28-19)14-23-17-9-7-16(22)8-10-17/h5-13,23H,3-4,14H2,1-2H3/b19-13+ |
| InChIKey | USXCSSJJNRZXAL-CPNJWEJPSA-N |
| XLogP | 5.57 |
| TPSA | 35.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.47 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|