C27H22N2O4 — CID 99902183
(5E)-5-(anthracen-9-ylmethylidene)-1-(furan-2-ylmethyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione (PubChem CID 99902183) has the molecular formula C27H22N2O4 and a molecular weight of 438.48 g/mol. Its IUPAC name is (5E)-5-(anthracen-9-ylmethylidene)-1-(furan-2-ylmethyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione.
| Compound Name | (5E)-5-(anthracen-9-ylmethylidene)-1-(furan-2-ylmethyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 99902183 |
| Molecular Formula | C27H22N2O4 |
| Molecular Weight | 438.48 g/mol |
| Exact Mass | 438.16 |
| IUPAC Name | (5E)-5-(anthracen-9-ylmethylidene)-1-(furan-2-ylmethyl)-3-propan-2-yl-1,3-diazinane-2,4,6-trione |
| SMILES | CC(C)N1C(=O)/C(=C/c2c3ccccc3cc3ccccc23)C(=O)N(Cc2ccco2)C1=O |
| InChI | InChI=1S/C27H22N2O4/c1-17(2)29-26(31)24(25(30)28(27(29)32)16-20-10-7-13-33-20)15-23-21-11-5-3-8-18(21)14-19-9-4-6-12-22(19)23/h3-15,17H,16H2,1-2H3/b24-15+ |
| InChIKey | YCXGHFCVHZSBBB-BUVRLJJBSA-N |
| XLogP | 5.37 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.48 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_six_het_A(483)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|