C13H15NO4S — CID 99903411
(3R)-1'-methylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one (PubChem CID 99903411) has the molecular formula C13H15NO4S and a molecular weight of 281.33 g/mol. Its IUPAC name is (3R)-1'-methylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one.
| Compound Name | (3R)-1'-methylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one |
|---|---|
| PubChem CID | 99903411 |
| Molecular Formula | C13H15NO4S |
| Molecular Weight | 281.33 g/mol |
| Exact Mass | 281.07 |
| IUPAC Name | (3R)-1'-methylsulfonylspiro[2-benzofuran-3,3'-piperidine]-1-one |
| SMILES | CS(=O)(=O)N1CCC[C@@]2(C1)OC(=O)c1ccccc12 |
| InChI | InChI=1S/C13H15NO4S/c1-19(16,17)14-8-4-7-13(9-14)11-6-3-2-5-10(11)12(15)18-13/h2-3,5-6H,4,7-9H2,1H3/t13-/m0/s1 |
| InChIKey | YINJBXTWPUYKDN-ZDUSSCGKSA-N |
| XLogP | 1.11 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.33 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |