C19H23NO2 — CID 99903712
[(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-(4-phenyloxan-4-yl)methanone (PubChem CID 99903712) has the molecular formula C19H23NO2 and a molecular weight of 297.40 g/mol. Its IUPAC name is [(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-(4-phenyloxan-4-yl)methanone.
| Compound Name | [(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-(4-phenyloxan-4-yl)methanone |
|---|---|
| PubChem CID | 99903712 |
| Molecular Formula | C19H23NO2 |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | [(1R,5R)-8-azabicyclo[3.2.1]oct-2-en-8-yl]-(4-phenyloxan-4-yl)methanone |
| SMILES | O=C(N1[C@H]2CC=C[C@H]1CC2)C1(c2ccccc2)CCOCC1 |
| InChI | InChI=1S/C19H23NO2/c21-18(20-16-7-4-8-17(20)10-9-16)19(11-13-22-14-12-19)15-5-2-1-3-6-15/h1-7,16-17H,8-14H2/t16-,17-/m0/s1 |
| InChIKey | MKRBGPHJRKJQBF-IRXDYDNUSA-N |
| XLogP | 3.05 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|