C20H31N3O2 — CID 99926435
(2S)-N-(1-ethylpiperidin-4-yl)-N-(2-pyridin-2-ylethyl)oxane-2-carboxamide (PubChem CID 99926435) has the molecular formula C20H31N3O2 and a molecular weight of 345.49 g/mol. Its IUPAC name is (2S)-N-(1-ethylpiperidin-4-yl)-N-(2-pyridin-2-ylethyl)oxane-2-carboxamide.
| Compound Name | (2S)-N-(1-ethylpiperidin-4-yl)-N-(2-pyridin-2-ylethyl)oxane-2-carboxamide |
|---|---|
| PubChem CID | 99926435 |
| Molecular Formula | C20H31N3O2 |
| Molecular Weight | 345.49 g/mol |
| Exact Mass | 345.24 |
| IUPAC Name | (2S)-N-(1-ethylpiperidin-4-yl)-N-(2-pyridin-2-ylethyl)oxane-2-carboxamide |
| SMILES | CCN1CCC(N(CCc2ccccn2)C(=O)[C@@H]2CCCCO2)CC1 |
| InChI | InChI=1S/C20H31N3O2/c1-2-22-13-10-18(11-14-22)23(15-9-17-7-3-5-12-21-17)20(24)19-8-4-6-16-25-19/h3,5,7,12,18-19H,2,4,6,8-11,13-16H2,1H3/t19-/m0/s1 |
| InChIKey | HPKDOMASSJWFNA-IBGZPJMESA-N |
| XLogP | 2.51 |
| TPSA | 45.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.49 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |